C20H19ClN2O5S — CID 2565072
2-chloro-N-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)-methylsulfamoyl]benzamide (PubChem CID 2565072) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)-methylsulfamoyl]benzamide.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 2565072 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)-methylsulfamoyl]benzamide |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(Cl)c(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C20H19ClN2O5S/c1-23(18-7-3-4-8-19(18)27-2)29(25,26)15-9-10-17(21)16(12-15)20(24)22-13-14-6-5-11-28-14/h3-12H,13H2,1-2H3,(H,22,24) |
| InChIKey | OOYGBTGZDCPTKO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |