C15H22ClN3O4S — CID 110356795
N-(4-acetamidobutyl)-2-chloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 110356795) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-2-chloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(4-acetamidobutyl)-2-chloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 110356795 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(4-acetamidobutyl)-2-chloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CC(=O)NCCCCNC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C15H22ClN3O4S/c1-11(20)17-8-4-5-9-18-15(21)13-10-12(6-7-14(13)16)24(22,23)19(2)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | AQSQESWXQOREJV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|