C18H27ClN2O5S — CID 31839407
methyl 6-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]hexanoate (PubChem CID 31839407) has the molecular formula C18H27ClN2O5S and a molecular weight of 418.94 g/mol. Its IUPAC name is methyl 6-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 31839407 |
| Molecular Formula | C18H27ClN2O5S |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | methyl 6-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]hexanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCCCCC(=O)OC)c1 |
| InChI | InChI=1S/C18H27ClN2O5S/c1-4-21(5-2)27(24,25)14-10-11-16(19)15(13-14)18(23)20-12-8-6-7-9-17(22)26-3/h10-11,13H,4-9,12H2,1-3H3,(H,20,23) |
| InChIKey | BVQZAMBZWZTKCK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|