C19H21Cl3N2O3S — CID 60566384
2-chloro-N-[2-(2,6-dichlorophenyl)ethyl]-5-(diethylsulfamoyl)benzamide (PubChem CID 60566384) has the molecular formula C19H21Cl3N2O3S and a molecular weight of 463.81 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,6-dichlorophenyl)ethyl]-5-(diethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[2-(2,6-dichlorophenyl)ethyl]-5-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 60566384 |
| Molecular Formula | C19H21Cl3N2O3S |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 2-chloro-N-[2-(2,6-dichlorophenyl)ethyl]-5-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl3N2O3S/c1-3-24(4-2)28(26,27)13-8-9-18(22)15(12-13)19(25)23-11-10-14-16(20)6-5-7-17(14)21/h5-9,12H,3-4,10-11H2,1-2H3,(H,23,25) |
| InChIKey | JNNDWQVUILIZCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |