C19H30ClN3O3S — CID 46387530
N-[2-(azepan-1-yl)ethyl]-2-chloro-5-(diethylsulfamoyl)benzamide (PubChem CID 46387530) has the molecular formula C19H30ClN3O3S and a molecular weight of 415.99 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-2-chloro-5-(diethylsulfamoyl)benzamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46387530 |
| Molecular Formula | C19H30ClN3O3S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCN2CCCCCC2)c1 |
| InChI | InChI=1S/C19H30ClN3O3S/c1-3-23(4-2)27(25,26)16-9-10-18(20)17(15-16)19(24)21-11-14-22-12-7-5-6-8-13-22/h9-10,15H,3-8,11-14H2,1-2H3,(H,21,24) |
| InChIKey | VGFAPCCSSKDYDC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |