C13H19ClN2O3S — CID 46665691
2-chloro-5-(methylsulfamoyl)-N-pentylbenzamide (PubChem CID 46665691) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-chloro-5-(methylsulfamoyl)-N-pentylbenzamide.
| Compound Name | 2-chloro-5-(methylsulfamoyl)-N-pentylbenzamide |
|---|---|
| PubChem CID | 46665691 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-chloro-5-(methylsulfamoyl)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(S(=O)(=O)NC)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c1-3-4-5-8-16-13(17)11-9-10(6-7-12(11)14)20(18,19)15-2/h6-7,9,15H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | WEQLNXZYQFVAPZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|