C16H23ClN2O3S — CID 38856928
2-chloro-N-(3-cyclopentylpropyl)-5-(methylsulfamoyl)benzamide (PubChem CID 38856928) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is 2-chloro-N-(3-cyclopentylpropyl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-(3-cyclopentylpropyl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 38856928 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-chloro-N-(3-cyclopentylpropyl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NCCCC2CCCC2)c1 |
| InChI | InChI=1S/C16H23ClN2O3S/c1-18-23(21,22)13-8-9-15(17)14(11-13)16(20)19-10-4-7-12-5-2-3-6-12/h8-9,11-12,18H,2-7,10H2,1H3,(H,19,20) |
| InChIKey | XBIOMIJSNVCWIJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|