C18H25ClN2O5S — CID 7975082
[(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate (PubChem CID 7975082) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7975082 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)O[C@H](C)C(=O)NCC2CCCCC2)c1 |
| InChI | InChI=1S/C18H25ClN2O5S/c1-12(17(22)21-11-13-6-4-3-5-7-13)26-18(23)15-10-14(8-9-16(15)19)27(24,25)20-2/h8-10,12-13,20H,3-7,11H2,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | NKCACXAJQOFMLD-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |