C15H19ClN2O5S — CID 42902648
[1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 42902648) has the molecular formula C15H19ClN2O5S and a molecular weight of 374.85 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42902648 |
| Molecular Formula | C15H19ClN2O5S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CC(OC(=O)c1cc(S(N)(=O)=O)ccc1Cl)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H19ClN2O5S/c1-9(14(19)18-10-4-2-3-5-10)23-15(20)12-8-11(24(17,21)22)6-7-13(12)16/h6-10H,2-5H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | BMRHUSMDLUESAJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |