C15H16Cl2FNO3 — CID 8651780
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8651780) has the molecular formula C15H16Cl2FNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8651780 |
| Molecular Formula | C15H16Cl2FNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H16Cl2FNO3/c1-8(14(20)19-9-4-2-3-5-9)22-15(21)10-6-13(18)12(17)7-11(10)16/h6-9H,2-5H2,1H3,(H,19,20)/t8-/m0/s1 |
| InChIKey | BHQBTCJICUFQFS-QMMMGPOBSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|