C18H23ClN2O4S — CID 8012760
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 8012760) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8012760 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)O[C@@H](C)C(=O)NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H23ClN2O4S/c1-11(16(22)21-18(24)20-12-6-4-3-5-7-12)25-17(23)14-10-13(26-2)8-9-15(14)19/h8-12H,3-7H2,1-2H3,(H2,20,21,22,24)/t11-/m0/s1 |
| InChIKey | LCJUALLJSYQGST-NSHDSACASA-N |
| XLogP | 3.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |