C16H19Cl2N3O4 — CID 8021667
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021667) has the molecular formula C16H19Cl2N3O4 and a molecular weight of 388.25 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021667 |
| Molecular Formula | C16H19Cl2N3O4 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cnc(Cl)c(Cl)c1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H19Cl2N3O4/c1-9(25-15(23)10-7-12(17)13(18)19-8-10)14(22)21-16(24)20-11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H2,20,21,22,24)/t9-/m1/s1 |
| InChIKey | YMSHOGMIQVWVFM-SECBINFHSA-N |
| XLogP | 3.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|