C14H17ClN2O3 — CID 2628800
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 2628800) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2628800 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)nc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-9(13(18)17-11-4-2-3-5-11)20-14(19)10-6-7-12(15)16-8-10/h6-9,11H,2-5H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | WOQJIRMIQNMMBN-SECBINFHSA-N |
| XLogP | 2.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|