C17H23ClN2O3 — CID 1431901
[(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 1431901) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 1431901 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2S)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | CC(C)[C@H](OC(=O)c1ccc(Cl)nc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(2)15(16(21)20-13-6-4-3-5-7-13)23-17(22)12-8-9-14(18)19-10-12/h8-11,13,15H,3-7H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | MSKROYPTTQIWLA-HNNXBMFYSA-N |
| XLogP | 3.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|