C15H21ClN2O3 — CID 7407633
[(2R)-1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 7407633) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is [(2R)-1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7407633 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [(2R)-1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | CC(C)[C@@H](OC(=O)c1ccc(Cl)nc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(2)12(13(19)18-15(3,4)5)21-14(20)10-6-7-11(16)17-8-10/h6-9,12H,1-5H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | BLNRCLVXBGUIFJ-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|