C15H21NO3S — CID 1470115
[(2S)-1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate (PubChem CID 1470115) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate.
| Compound Name | [(2S)-1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1470115 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate |
| SMILES | CC(C)[C@H](OC(=O)c1cccs1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H21NO3S/c1-10(2)13(14(17)16-11-6-3-4-7-11)19-15(18)12-8-5-9-20-12/h5,8-11,13H,3-4,6-7H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | VMWLORNFAFPJFI-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |