C17H18FNO3S — CID 1470122
[(2R)-1-[(4-fluorophenyl)methylamino]-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate (PubChem CID 1470122) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is [(2R)-1-[(4-fluorophenyl)methylamino]-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate.
| Compound Name | [(2R)-1-[(4-fluorophenyl)methylamino]-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1470122 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [(2R)-1-[(4-fluorophenyl)methylamino]-3-methyl-1-oxobutan-2-yl] thiophene-2-carboxylate |
| SMILES | CC(C)[C@@H](OC(=O)c1cccs1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO3S/c1-11(2)15(22-17(21)14-4-3-9-23-14)16(20)19-10-12-5-7-13(18)8-6-12/h3-9,11,15H,10H2,1-2H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | LNFHKRMYUROUFW-OAHLLOKOSA-N |
| XLogP | 3.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |