C16H16N2O4S — CID 46619463
[1-(benzylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate (PubChem CID 46619463) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate.
| Compound Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46619463 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1cccs1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-11(22-15(20)13-8-5-9-23-13)14(19)18-16(21)17-10-12-6-3-2-4-7-12/h2-9,11H,10H2,1H3,(H2,17,18,19,21) |
| InChIKey | RPLPCIWYGKOSKJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |