C10H12N2O4S — CID 16524144
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate (PubChem CID 16524144) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16524144 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] thiophene-2-carboxylate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1cccs1 |
| InChI | InChI=1S/C10H12N2O4S/c1-6(8(13)12-10(15)11-2)16-9(14)7-4-3-5-17-7/h3-6H,1-2H3,(H2,11,12,13,15) |
| InChIKey | YQLFDWDDPWHWLB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |