C13H16N2O4S — CID 8526457
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate (PubChem CID 8526457) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8526457 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate |
| SMILES | CNC(=O)NC(=O)[C@H](C)OC(=O)c1ccccc1SC |
| InChI | InChI=1S/C13H16N2O4S/c1-8(11(16)15-13(18)14-2)19-12(17)9-6-4-5-7-10(9)20-3/h4-8H,1-3H3,(H2,14,15,16,18)/t8-/m0/s1 |
| InChIKey | FNDASJNKOCNSHF-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |