C19H19NO4S — CID 8735820
[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate (PubChem CID 8735820) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate.
| Compound Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8735820 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)O[C@H](C)C(=O)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C19H19NO4S/c1-12(21)14-8-4-6-10-16(14)20-18(22)13(2)24-19(23)15-9-5-7-11-17(15)25-3/h4-11,13H,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | KSGPVXNMAHPKCT-CYBMUJFWSA-N |
| XLogP | 3.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |