C10H11ClN2O4S — CID 7146722
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate (PubChem CID 7146722) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7146722 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H11ClN2O4S/c1-5(8(14)13-10(16)12-2)17-9(15)6-3-4-7(11)18-6/h3-5H,1-2H3,(H2,12,13,14,16)/t5-/m1/s1 |
| InChIKey | BSIOHTRKHAUXGL-RXMQYKEDSA-N |
| XLogP | 1.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |