C15H14ClNO4S — CID 7284005
[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate (PubChem CID 7284005) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7284005 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 5-chlorothiophene-2-carboxylate |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)OC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-9(21-15(19)12-7-8-13(16)22-12)14(18)17-10-5-3-4-6-11(10)20-2/h3-9H,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | DRIONULUUULQBX-SECBINFHSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |