C12H12Cl2N2O4 — CID 16523243
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3,5-dichlorobenzoate (PubChem CID 16523243) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3,5-dichlorobenzoate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 16523243 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3,5-dichlorobenzoate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O4/c1-6(10(17)16-12(19)15-2)20-11(18)7-3-8(13)5-9(14)4-7/h3-6H,1-2H3,(H2,15,16,17,19) |
| InChIKey | GGLAIYPSGBOOLP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |