C18H25ClN2O6 — CID 7684484
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate (PubChem CID 7684484) has the molecular formula C18H25ClN2O6 and a molecular weight of 400.86 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate |
|---|---|
| PubChem CID | 7684484 |
| Molecular Formula | C18H25ClN2O6 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-ethoxybenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)O[C@@H](C)C(=O)NC(=O)NC)cc1OCC |
| InChI | InChI=1S/C18H25ClN2O6/c1-5-7-8-26-15-13(19)9-12(10-14(15)25-6-2)17(23)27-11(3)16(22)21-18(24)20-4/h9-11H,5-8H2,1-4H3,(H2,20,21,22,24)/t11-/m0/s1 |
| InChIKey | PLMFMTGKJHJROF-NSHDSACASA-N |
| XLogP | 2.92 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|