C15H20ClNO5 — CID 7952399
[(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-methoxybenzoate (PubChem CID 7952399) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-methoxybenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-methoxybenzoate |
|---|---|
| PubChem CID | 7952399 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-chloro-5-methoxybenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)O[C@@H](C)C(N)=O)cc1OC |
| InChI | InChI=1S/C15H20ClNO5/c1-4-5-6-21-13-11(16)7-10(8-12(13)20-3)15(19)22-9(2)14(17)18/h7-9H,4-6H2,1-3H3,(H2,17,18)/t9-/m0/s1 |
| InChIKey | OHRROZKORJCVMV-VIFPVBQESA-N |
| XLogP | 2.56 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|