[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate

C11H11Cl2NO4 — CID 9126007

IUPAC[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate
SMILESCOc1c(Cl)cc(C(=O)O[C@H](C)C(N)=O)cc1Cl
InChIInChI=1S/C11H11Cl2NO4/c1-5(10(14)15)18-11(16)6-3-7(12)9(17-2)8(13)4-6/h3-5H,1-2H3,(H2,14,15)/t5-/m1/s1
InChIKeyAWARFSUXFDZGAX-RXMQYKEDSA-N
MW292.12 g/mol
LogP2.03
Rot. Bonds4

About [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate

[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate (PubChem CID 9126007) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate.

Molecular Properties

Compound Name[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate
PubChem CID9126007
Molecular FormulaC11H11Cl2NO4
Molecular Weight292.12 g/mol
Exact Mass291.01
IUPAC Name[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate
SMILESCOc1c(Cl)cc(C(=O)O[C@H](C)C(N)=O)cc1Cl
InChIInChI=1S/C11H11Cl2NO4/c1-5(10(14)15)18-11(16)6-3-7(12)9(17-2)8(13)4-6/h3-5H,1-2H3,(H2,14,15)/t5-/m1/s1
InChIKeyAWARFSUXFDZGAX-RXMQYKEDSA-N
XLogP2.03
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.12
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate?
The IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate (CID 9126007) is [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate.
What is the SMILES notation for [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate?
The canonical SMILES for [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate is COc1c(Cl)cc(C(=O)O[C@H](C)C(N)=O)cc1Cl.
What is the InChIKey of [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate?
The InChIKey is AWARFSUXFDZGAX-RXMQYKEDSA-N. The full InChI is InChI=1S/C11H11Cl2NO4/c1-5(10(14)15)18-11(16)6-3-7(12)9(17-2)8(13)4-6/h3-5H,1-2H3,(H2,14,15)/t5-/m1/s1.
What are the key properties of [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate?
[(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate has a molecular weight of 292.12 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-amino-1-oxopropan-2-yl] 3,5-dichloro-4-methoxybenzoate is sourced from PubChem (CID 9126007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).