C16H23NO6 — CID 6914992
(1-amino-1-oxopropan-2-yl) 3,4,5-triethoxybenzoate (PubChem CID 6914992) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 3,4,5-triethoxybenzoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 6914992 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OC(C)C(N)=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H23NO6/c1-5-20-12-8-11(16(19)23-10(4)15(17)18)9-13(21-6-2)14(12)22-7-3/h8-10H,5-7H2,1-4H3,(H2,17,18) |
| InChIKey | QTRITNVSECBWAT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |