C19H27NO6 — CID 51907878
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3,4,5-triethoxybenzoate (PubChem CID 51907878) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 51907878 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3,4,5-triethoxybenzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C19H27NO6/c1-6-10-20-18(21)13(5)26-19(22)14-11-15(23-7-2)17(25-9-4)16(12-14)24-8-3/h6,11-13H,1,7-10H2,2-5H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | IGCCEHBJENUYJC-ZDUSSCGKSA-N |
| XLogP | 2.73 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|