C14H15F2NO5S — CID 8951920
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 8951920) has the molecular formula C14H15F2NO5S and a molecular weight of 347.34 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 8951920 |
| Molecular Formula | C14H15F2NO5S |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H15F2NO5S/c1-3-8-17-12(18)9(2)22-13(19)10-4-6-11(7-5-10)23(20,21)14(15)16/h3-7,9,14H,1,8H2,2H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | DTJJBELXBWVZCL-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|