C16H18N2O5S — CID 9382937
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(cyanomethylsulfonylmethyl)benzoate (PubChem CID 9382937) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(cyanomethylsulfonylmethyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(cyanomethylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 9382937 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(cyanomethylsulfonylmethyl)benzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1ccc(CS(=O)(=O)CC#N)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-3-9-18-15(19)12(2)23-16(20)14-6-4-13(5-7-14)11-24(21,22)10-8-17/h3-7,12H,1,9-11H2,2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | DPAVADVCHQSBLU-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|