C21H25NO5S — CID 7753033
[(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 7753033) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7753033 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [(2S)-1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CC(C)c1ccc(NC(=O)[C@H](C)OC(=O)c2ccc(CS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-14(2)17-9-11-19(12-10-17)22-20(23)15(3)27-21(24)18-7-5-16(6-8-18)13-28(4,25)26/h5-12,14-15H,13H2,1-4H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | DVMCLACMTQRBBL-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |