C22H21NO5S — CID 7753088
[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 7753088) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7753088 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(CS(C)(=O)=O)cc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H21NO5S/c1-15(21(24)23-20-12-11-17-5-3-4-6-19(17)13-20)28-22(25)18-9-7-16(8-10-18)14-29(2,26)27/h3-13,15H,14H2,1-2H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | GBVIEDVOLBESBH-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |