C18H20N2O3 — CID 23971941
[1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] pyridine-4-carboxylate (PubChem CID 23971941) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] pyridine-4-carboxylate.
| Compound Name | [1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 23971941 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [1-oxo-1-(4-propan-2-ylanilino)propan-2-yl] pyridine-4-carboxylate |
| SMILES | CC(OC(=O)c1ccncc1)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-12(2)14-4-6-16(7-5-14)20-17(21)13(3)23-18(22)15-8-10-19-11-9-15/h4-13H,1-3H3,(H,20,21) |
| InChIKey | JUEBCMCCCLZIBP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |