C14H14N2O3S — CID 18091054
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 1,3-benzothiazole-6-carboxylate (PubChem CID 18091054) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1,3-benzothiazole-6-carboxylate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 18091054 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCNC(=O)C(C)OC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H14N2O3S/c1-3-6-15-13(17)9(2)19-14(18)10-4-5-11-12(7-10)20-8-16-11/h3-5,7-9H,1,6H2,2H3,(H,15,17) |
| InChIKey | WVRWATOKFHFQCA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|