C18H20N2O4S — CID 9063370
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate (PubChem CID 9063370) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 9063370 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1ccc(OCc2csc(C)n2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-4-9-19-17(21)12(2)24-18(22)14-5-7-16(8-6-14)23-10-15-11-25-13(3)20-15/h4-8,11-12H,1,9-10H2,2-3H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | DYBDIDUYPPPDKC-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|