C17H18N2O3S2 — CID 18170167
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(1,3-thiazol-4-ylmethylsulfanyl)benzoate (PubChem CID 18170167) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(1,3-thiazol-4-ylmethylsulfanyl)benzoate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(1,3-thiazol-4-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 18170167 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 4-(1,3-thiazol-4-ylmethylsulfanyl)benzoate |
| SMILES | C=CCNC(=O)C(C)OC(=O)c1ccc(SCc2cscn2)cc1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-3-8-18-16(20)12(2)22-17(21)13-4-6-15(7-5-13)24-10-14-9-23-11-19-14/h3-7,9,11-12H,1,8,10H2,2H3,(H,18,20) |
| InChIKey | ZKENYXFBZSVQAA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|