C15H21NO3S — CID 8994629
[(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate (PubChem CID 8994629) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate.
| Compound Name | [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8994629 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(2R)-1-(2-methylpropylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)O[C@H](C)C(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-10(2)9-16-14(17)11(3)19-15(18)12-5-7-13(20-4)8-6-12/h5-8,10-11H,9H2,1-4H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | SRKIBENEEYMUKP-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |