C16H17NO4S — CID 8507677
[(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate (PubChem CID 8507677) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8507677 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)O[C@@H](C)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-11(15(18)17-10-13-4-3-9-20-13)21-16(19)12-5-7-14(22-2)8-6-12/h3-9,11H,10H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | WPOGXAAYNHNYNX-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |