C14H12Cl2N2O4 — CID 8021648
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021648) has the molecular formula C14H12Cl2N2O4 and a molecular weight of 343.17 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021648 |
| Molecular Formula | C14H12Cl2N2O4 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cnc(Cl)c(Cl)c1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H12Cl2N2O4/c1-8(13(19)18-7-10-3-2-4-21-10)22-14(20)9-5-11(15)12(16)17-6-9/h2-6,8H,7H2,1H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | ZWZIFGMRYHBLTH-MRVPVSSYSA-N |
| XLogP | 2.84 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|