C14H15N3O4 — CID 7760510
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate (PubChem CID 7760510) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7760510 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)O[C@H](C)C(=O)NCc2ccco2)cn1 |
| InChI | InChI=1S/C14H15N3O4/c1-9-6-16-12(8-15-9)14(19)21-10(2)13(18)17-7-11-4-3-5-20-11/h3-6,8,10H,7H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | LVTWQHZLFITYLT-SNVBAGLBSA-N |
| XLogP | 1.24 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |