C14H15NO5 — CID 29193764
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylfuran-2-carboxylate (PubChem CID 29193764) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylfuran-2-carboxylate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 29193764 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 5-methylfuran-2-carboxylate |
| SMILES | Cc1ccc(C(=O)O[C@H](C)C(=O)NCc2ccco2)o1 |
| InChI | InChI=1S/C14H15NO5/c1-9-5-6-12(19-9)14(17)20-10(2)13(16)15-8-11-4-3-7-18-11/h3-7,10H,8H2,1-2H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | SFAZVAQZOOCXHD-SNVBAGLBSA-N |
| XLogP | 2.04 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |