C15H15ClN2O4 — CID 30699194
[(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate (PubChem CID 30699194) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate.
| Compound Name | [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 30699194 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [(2S)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)c(N)c1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H15ClN2O4/c1-9(14(19)18-8-11-3-2-6-21-11)22-15(20)10-4-5-12(16)13(17)7-10/h2-7,9H,8,17H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | GDUFFEMFXVZQJF-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|