C15H13ClFNO4 — CID 7820560
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate (PubChem CID 7820560) has the molecular formula C15H13ClFNO4 and a molecular weight of 325.72 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7820560 |
| Molecular Formula | C15H13ClFNO4 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1c(F)cccc1Cl)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H13ClFNO4/c1-9(14(19)18-8-10-4-3-7-21-10)22-15(20)13-11(16)5-2-6-12(13)17/h2-7,9H,8H2,1H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | GVUXFAACJWSPNC-SECBINFHSA-N |
| XLogP | 2.93 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |