C17H15ClFNO3 — CID 7504051
[(2S)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate (PubChem CID 7504051) has the molecular formula C17H15ClFNO3 and a molecular weight of 335.76 g/mol. Its IUPAC name is [(2S)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate.
| Compound Name | [(2S)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7504051 |
| Molecular Formula | C17H15ClFNO3 |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [(2S)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(F)cccc1Cl)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H15ClFNO3/c1-11(16(21)20-10-12-6-3-2-4-7-12)23-17(22)15-13(18)8-5-9-14(15)19/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | OQTNFBFJEBBNCE-NSHDSACASA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |