C20H15ClFNO3 — CID 7820596
[(2R)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate (PubChem CID 7820596) has the molecular formula C20H15ClFNO3 and a molecular weight of 371.80 g/mol. Its IUPAC name is [(2R)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate.
| Compound Name | [(2R)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7820596 |
| Molecular Formula | C20H15ClFNO3 |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | [(2R)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 2-chloro-6-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1c(F)cccc1Cl)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H15ClFNO3/c1-12(26-20(25)18-15(21)9-5-10-16(18)22)19(24)23-17-11-4-7-13-6-2-3-8-14(13)17/h2-12H,1H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | YLZCVAZLHLZNGM-GFCCVEGCSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |