C22H16ClNO3S — CID 7824744
[(2S)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 7824744) has the molecular formula C22H16ClNO3S and a molecular weight of 409.89 g/mol. Its IUPAC name is [(2S)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2S)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7824744 |
| Molecular Formula | C22H16ClNO3S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [(2S)-1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1sc2ccccc2c1Cl)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H16ClNO3S/c1-13(21(25)24-17-11-6-8-14-7-2-3-9-15(14)17)27-22(26)20-19(23)16-10-4-5-12-18(16)28-20/h2-13H,1H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | SJFZBSBAIGWFFJ-ZDUSSCGKSA-N |
| XLogP | 5.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |