C19H16ClNO3S — CID 16528492
[1-(4-methylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 16528492) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is [1-(4-methylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16528492 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H16ClNO3S/c1-11-7-9-13(10-8-11)21-18(22)12(2)24-19(23)17-16(20)14-5-3-4-6-15(14)25-17/h3-10,12H,1-2H3,(H,21,22) |
| InChIKey | NTZQGWVRFPMKPK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |