C17H14ClNO4S — CID 7395243
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 7395243) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7395243 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1sc2ccccc2c1Cl)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H14ClNO4S/c1-10(16(20)19-9-11-5-4-8-22-11)23-17(21)15-14(18)12-6-2-3-7-13(12)24-15/h2-8,10H,9H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | CYLBOCLSHIYCHK-SNVBAGLBSA-N |
| XLogP | 4.01 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |