C20H16ClNO4S — CID 7812444
[(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 7812444) has the molecular formula C20H16ClNO4S and a molecular weight of 401.87 g/mol. Its IUPAC name is [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7812444 |
| Molecular Formula | C20H16ClNO4S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@H](C)OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C20H16ClNO4S/c1-11(23)13-7-9-14(10-8-13)22-19(24)12(2)26-20(25)18-17(21)15-5-3-4-6-16(15)27-18/h3-10,12H,1-2H3,(H,22,24)/t12-/m0/s1 |
| InChIKey | QRUKADNMAPEDPH-LBPRGKRZSA-N |
| XLogP | 4.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |